CymitQuimica logo

CAS 1099597-27-9

:

1,3,5-Trifluoro-2-(2,2,2-trifluoroethyl)benzene

Description:
1,3,5-Trifluoro-2-(2,2,2-trifluoroethyl)benzene is a fluorinated aromatic compound characterized by the presence of three fluorine atoms attached to the benzene ring at the 1, 3, and 5 positions, along with a trifluoroethyl substituent at the 2-position. This structure imparts unique chemical properties, including increased lipophilicity and thermal stability, making it of interest in various applications such as in the development of specialty chemicals and materials. The presence of multiple fluorine atoms enhances its resistance to degradation and influences its reactivity, often making it less reactive than its non-fluorinated counterparts. Additionally, the compound may exhibit distinct physical properties, such as a higher boiling point and lower volatility due to the strong C-F bonds. Its potential uses could extend to fields like pharmaceuticals, agrochemicals, and advanced materials, although specific applications would depend on further research into its behavior and interactions in different environments. Safety and environmental considerations are also crucial, given the persistence of fluorinated compounds in the environment.
Formula:C8H4F6
InChI:InChI=1S/C8H4F6/c9-4-1-6(10)5(7(11)2-4)3-8(12,13)14/h1-2H,3H2
InChI key:InChIKey=WGGCLJPIVXNHBN-UHFFFAOYSA-N
SMILES:C(C(F)(F)F)C1=C(F)C=C(F)C=C1F
Synonyms:
  • Benzene, 1,3,5-trifluoro-2-(2,2,2-trifluoroethyl)-
  • 1,3,5-Trifluoro-2-(2,2,2-trifluoroethyl)benzene
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.