CAS 1099597-28-0

1,2,3-Trifluoro-5-(2,2,2-trifluoroethyl)benzene

Description:

1,2,3-Trifluoro-5-(2,2,2-trifluoroethyl)benzene is a fluorinated aromatic compound characterized by the presence of three fluorine atoms on the benzene ring and a trifluoroethyl substituent. This compound exhibits unique properties due to the electronegative fluorine atoms, which enhance its chemical stability and influence its reactivity. The trifluoroethyl group contributes to its lipophilicity, making it less polar compared to non-fluorinated analogs. As a result, it may have applications in various fields, including pharmaceuticals and agrochemicals, where fluorinated compounds are often sought for their improved metabolic stability and bioavailability. The presence of multiple fluorine atoms can also affect the compound's boiling point, melting point, and solubility in organic solvents. Additionally, the compound's structure may impart specific interactions with biological targets, making it of interest in medicinal chemistry. Safety and handling considerations are important due to the potential toxicity associated with fluorinated compounds, necessitating appropriate precautions during laboratory use.

Formula: C₈H₄F₆

InChI: InChI=1S/C8H4F6/c9-5-1-4(3-8(12,13)14)2-6(10)7(5)11/h1-2H,3H2

InChI key: InChIKey=MGZWYYBATIFNHJ-UHFFFAOYSA-N

SMILES: C(C(F)(F)F)C1=CC(F)=C(F)C(F)=C1

Synonyms:

• 1,2,3-Trifluoro-5-(2,2,2-trifluoroethyl)benzene
• Benzene, 1,2,3-trifluoro-5-(2,2,2-trifluoroethyl)-