
CAS 1099597-29-1
:1-Chloro-3-fluoro-2-(2,2,2-trifluoroethyl)benzene
Description:
1-Chloro-3-fluoro-2-(2,2,2-trifluoroethyl)benzene is an aromatic compound characterized by the presence of a benzene ring substituted with a chlorine atom, a fluorine atom, and a trifluoroethyl group. This compound features a chlorinated and fluorinated structure, which can influence its chemical reactivity and physical properties. The presence of multiple fluorine atoms typically enhances the compound's lipophilicity and thermal stability, making it potentially useful in various applications, including pharmaceuticals and agrochemicals. The trifluoroethyl group contributes to the compound's unique electronic properties and can affect its solubility in organic solvents. Additionally, the chlorine and fluorine substituents can impact the compound's reactivity, making it a subject of interest in synthetic chemistry. Overall, 1-Chloro-3-fluoro-2-(2,2,2-trifluoroethyl)benzene exhibits characteristics typical of halogenated aromatic compounds, including potential applications in material science and medicinal chemistry.
Formula:C8H5ClF4
InChI:InChI=1S/C8H5ClF4/c9-6-2-1-3-7(10)5(6)4-8(11,12)13/h1-3H,4H2
InChI key:InChIKey=BWEOIASLWNGZGE-UHFFFAOYSA-N
SMILES:C(C(F)(F)F)C1=C(Cl)C=CC=C1F
Synonyms:- Benzene, 1-chloro-3-fluoro-2-(2,2,2-trifluoroethyl)-
- 1-Chloro-3-fluoro-2-(2,2,2-trifluoroethyl)benzene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.