CymitQuimica logo

CAS 1099597-37-1

:

2-Fluoro-1-methyl-4-(2,2,2-trifluoroethyl)benzene

Description:
2-Fluoro-1-methyl-4-(2,2,2-trifluoroethyl)benzene, with the CAS number 1099597-37-1, is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with a fluorine atom, a methyl group, and a trifluoroethyl group. The presence of the fluorine atoms contributes to its unique chemical properties, such as increased lipophilicity and potential stability against degradation. This compound is likely to exhibit low volatility and high thermal stability due to the strong C-F bonds. Its trifluoroethyl substituent can enhance its reactivity in certain chemical reactions, making it of interest in various applications, including pharmaceuticals and agrochemicals. Additionally, the compound's fluorinated nature may impart specific biological activities, which could be relevant in medicinal chemistry. Overall, 2-Fluoro-1-methyl-4-(2,2,2-trifluoroethyl)benzene represents a class of fluorinated aromatic compounds that are valuable in both industrial and research contexts.
Formula:C9H8F4
InChI:InChI=1S/C9H8F4/c1-6-2-3-7(4-8(6)10)5-9(11,12)13/h2-4H,5H2,1H3
InChI key:InChIKey=GGOOILQVTQZFDA-UHFFFAOYSA-N
SMILES:C(C(F)(F)F)C1=CC(F)=C(C)C=C1
Synonyms:
  • Benzene, 2-fluoro-1-methyl-4-(2,2,2-trifluoroethyl)-
  • 2-Fluoro-1-methyl-4-(2,2,2-trifluoroethyl)benzene
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.