CAS 1099597-44-0

1-(1-Methylethyl)-4-(2,2,2-trifluoroethyl)benzene

Description:

1-(1-Methylethyl)-4-(2,2,2-trifluoroethyl)benzene, also known by its CAS number 1099597-44-0, is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with both isopropyl and trifluoroethyl groups. The presence of the trifluoroethyl group imparts unique properties, such as increased hydrophobicity and potential volatility, while the isopropyl group contributes to steric hindrance. This compound is likely to exhibit low solubility in water due to its nonpolar characteristics, but it may dissolve in organic solvents. Its trifluoromethyl substituent can enhance the compound's stability and influence its reactivity, making it of interest in various chemical applications, including pharmaceuticals and agrochemicals. Additionally, the compound's structure suggests potential uses in materials science, particularly in the development of fluorinated polymers or specialty chemicals. Safety and handling considerations should be taken into account, as fluorinated compounds can exhibit unique toxicological profiles. Overall, this compound represents a fascinating example of how structural modifications can lead to diverse chemical behaviors and applications.

Formula: C₁₁H₁₃F₃

InChI: InChI=1S/C11H13F3/c1-8(2)10-5-3-9(4-6-10)7-11(12,13)14/h3-6,8H,7H2,1-2H3

InChI key: InChIKey=DXHDYTBEGUNHQV-UHFFFAOYSA-N

SMILES: C(C(F)(F)F)C1=CC=C(C(C)C)C=C1

Synonyms:

• 1-(1-Methylethyl)-4-(2,2,2-trifluoroethyl)benzene
• Benzene, 1-(1-methylethyl)-4-(2,2,2-trifluoroethyl)-