CymitQuimica logo

CAS 1099597-46-2

:

1-Chloro-2-fluoro-3,5-bis(trifluoromethyl)benzene

Description:
1-Chloro-2-fluoro-3,5-bis(trifluoromethyl)benzene is a halogenated aromatic compound characterized by the presence of both chlorine and fluorine substituents on a benzene ring, along with two trifluoromethyl groups. This compound typically exhibits a high degree of lipophilicity due to the presence of multiple fluorinated groups, which can influence its solubility and reactivity. The trifluoromethyl groups contribute to its stability and can enhance its electron-withdrawing properties, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. The chlorine and fluorine atoms can also impart unique electronic characteristics, affecting the compound's reactivity and interaction with other substances. Additionally, the presence of multiple fluorine atoms can lead to increased thermal and chemical stability, making it suitable for applications in materials science and pharmaceuticals. Overall, 1-Chloro-2-fluoro-3,5-bis(trifluoromethyl)benzene is notable for its complex structure and potential utility in various chemical applications.
Formula:C8H2ClF7
InChI:InChI=1S/C8H2ClF7/c9-5-2-3(7(11,12)13)1-4(6(5)10)8(14,15)16/h1-2H
InChI key:InChIKey=UHSWOMNFWAWIOX-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=CC(C(F)(F)F)=CC(Cl)=C1F
Synonyms:
  • 1-Chloro-2-fluoro-3,5-bis(trifluoromethyl)benzene
  • Benzene, 1-chloro-2-fluoro-3,5-bis(trifluoromethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.