CymitQuimica logo

CAS 1099597-51-9

:

4-Fluoro-2-(2,2,2-trifluoroethyl)-1-(trifluoromethyl)benzene

Description:
4-Fluoro-2-(2,2,2-trifluoroethyl)-1-(trifluoromethyl)benzene is a fluorinated aromatic compound characterized by the presence of multiple fluorine substituents on its benzene ring. This compound features a trifluoromethyl group and a trifluoroethyl group, which contribute to its unique chemical properties, including increased lipophilicity and potential applications in pharmaceuticals and agrochemicals. The presence of fluorine atoms typically enhances the stability and reactivity of the compound, making it useful in various chemical reactions. Additionally, the compound's structure suggests it may exhibit interesting electronic properties due to the electron-withdrawing nature of the fluorine atoms. Its molecular interactions can be influenced by the steric and electronic effects of the substituents, which may affect its solubility and reactivity in different environments. Overall, 4-Fluoro-2-(2,2,2-trifluoroethyl)-1-(trifluoromethyl)benzene is a notable example of a fluorinated compound with potential utility in diverse chemical applications.
Formula:C9H5F7
InChI:InChI=1S/C9H5F7/c10-6-1-2-7(9(14,15)16)5(3-6)4-8(11,12)13/h1-3H,4H2
InChI key:InChIKey=PJMABSXZRNRSPU-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=C(CC(F)(F)F)C=C(F)C=C1
Synonyms:
  • 4-Fluoro-2-(2,2,2-trifluoroethyl)-1-(trifluoromethyl)benzene
  • Benzene, 4-fluoro-2-(2,2,2-trifluoroethyl)-1-(trifluoromethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.