CymitQuimica logo

CAS 1099597-56-4

:

2,4-Dichloro-1-(3,3,3-trifluoropropyl)benzene

Description:
2,4-Dichloro-1-(3,3,3-trifluoropropyl)benzene is an organic compound characterized by its aromatic structure, featuring a benzene ring substituted with two chlorine atoms at the 2 and 4 positions and a trifluoropropyl group at the 1 position. This compound is part of a class of chemicals known for their potential applications in various fields, including agrochemicals and pharmaceuticals. The presence of chlorine and trifluoromethyl groups contributes to its chemical stability and lipophilicity, which can influence its behavior in biological systems and environmental interactions. It is typically a colorless to pale yellow liquid or solid, depending on the temperature, and may exhibit moderate volatility. The trifluoropropyl group enhances its hydrophobic characteristics, making it less soluble in water but more soluble in organic solvents. Safety data should be consulted for handling, as halogenated compounds can pose environmental and health risks. Overall, 2,4-Dichloro-1-(3,3,3-trifluoropropyl)benzene is a notable compound in synthetic organic chemistry with specific functional properties.
Formula:C9H7Cl2F3
InChI:InChI=1S/C9H7Cl2F3/c10-7-2-1-6(8(11)5-7)3-4-9(12,13)14/h1-2,5H,3-4H2
InChI key:InChIKey=WDIXWWOSKOFIEO-UHFFFAOYSA-N
SMILES:C(CC(F)(F)F)C1=C(Cl)C=C(Cl)C=C1
Synonyms:
  • 2,4-Dichloro-1-(3,3,3-trifluoropropyl)benzene
  • Benzene, 2,4-dichloro-1-(3,3,3-trifluoropropyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.