
CAS 1099597-57-5
:1,2,3,4,5-Pentafluoro-6-(3,3,3-trifluoropropyl)benzene
Description:
1,2,3,4,5-Pentafluoro-6-(3,3,3-trifluoropropyl)benzene is a fluorinated aromatic compound characterized by a benzene ring substituted with five fluorine atoms and a trifluoropropyl group. The presence of multiple fluorine atoms imparts unique properties, such as increased hydrophobicity and thermal stability, making it useful in various applications, including specialty chemicals and materials. The trifluoropropyl substituent enhances the compound's volatility and can influence its reactivity and solubility in organic solvents. This compound is likely to exhibit low reactivity due to the strong C-F bonds, which are resistant to oxidation and hydrolysis. Additionally, the fluorinated nature of the compound may contribute to its potential as a surfactant or in applications requiring low surface tension. Safety considerations are important, as fluorinated compounds can pose environmental and health risks, necessitating careful handling and disposal. Overall, 1,2,3,4,5-Pentafluoro-6-(3,3,3-trifluoropropyl)benzene represents a class of compounds with significant industrial relevance due to their unique chemical properties.
Formula:C9H4F8
InChI:InChI=1S/C9H4F8/c10-4-3(1-2-9(15,16)17)5(11)7(13)8(14)6(4)12/h1-2H2
InChI key:InChIKey=FMUPCXGYMFKRMJ-UHFFFAOYSA-N
SMILES:C(CC(F)(F)F)C1=C(F)C(F)=C(F)C(F)=C1F
Synonyms:- Benzene, 1,2,3,4,5-pentafluoro-6-(3,3,3-trifluoropropyl)-
- 1,2,3,4,5-Pentafluoro-6-(3,3,3-trifluoropropyl)benzene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.