CymitQuimica logo

CAS 1099597-59-7

:

2-Chloro-4-fluoro-1-methyl-3-(2,2,2-trifluoroethyl)benzene

Description:
2-Chloro-4-fluoro-1-methyl-3-(2,2,2-trifluoroethyl)benzene is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with various halogen and alkyl groups. The presence of chlorine and fluorine atoms indicates that it is a halogenated compound, which often imparts unique chemical properties such as increased stability and potential reactivity in certain conditions. The trifluoroethyl group contributes to its lipophilicity, potentially affecting its solubility and interaction with biological systems. This compound may exhibit interesting electronic properties due to the electron-withdrawing nature of the fluorine atoms, which can influence its reactivity in electrophilic aromatic substitution reactions. Additionally, the presence of multiple fluorine atoms can enhance its thermal and chemical stability. Such characteristics make it of interest in various fields, including materials science and pharmaceuticals, where halogenated compounds are often explored for their unique properties and potential applications. Safety and handling considerations are essential due to the toxicity associated with halogenated organic compounds.
Formula:C9H7ClF4
InChI:InChI=1S/C9H7ClF4/c1-5-2-3-7(11)6(8(5)10)4-9(12,13)14/h2-3H,4H2,1H3
InChI key:InChIKey=YJJCALRLWYAPDH-UHFFFAOYSA-N
SMILES:C(C(F)(F)F)C1=C(Cl)C(C)=CC=C1F
Synonyms:
  • Benzene, 2-chloro-4-fluoro-1-methyl-3-(2,2,2-trifluoroethyl)-
  • 2-Chloro-4-fluoro-1-methyl-3-(2,2,2-trifluoroethyl)benzene
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.