CAS 1099597-64-4

1,3-Difluoro-4-methyl-2-(2,2,2-trifluoroethyl)benzene

Description:

1,3-Difluoro-4-methyl-2-(2,2,2-trifluoroethyl)benzene is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with two fluorine atoms at the 1 and 3 positions, a methyl group at the 4 position, and a trifluoroethyl group at the 2 position. This compound exhibits significant fluorine content, which can enhance its chemical stability and influence its physical properties, such as boiling and melting points. The presence of multiple fluorine atoms typically imparts hydrophobic characteristics, making it less soluble in water but potentially soluble in organic solvents. Additionally, the compound may exhibit unique reactivity patterns due to the electron-withdrawing nature of the fluorine substituents, which can affect its behavior in chemical reactions. Its applications may span various fields, including pharmaceuticals, agrochemicals, and materials science, where fluorinated compounds are often valued for their distinctive properties. Safety and handling considerations are essential due to the potential toxicity and environmental impact of fluorinated compounds.

Formula: C₉H₇F₅

InChI: InChI=1S/C9H7F5/c1-5-2-3-7(10)6(8(5)11)4-9(12,13)14/h2-3H,4H2,1H3

InChI key: InChIKey=UPIIBUDZHYESCS-UHFFFAOYSA-N

SMILES: C(C(F)(F)F)C1=C(F)C(C)=CC=C1F

Synonyms:

• Benzene, 1,3-difluoro-4-methyl-2-(2,2,2-trifluoroethyl)-
• 1,3-Difluoro-4-methyl-2-(2,2,2-trifluoroethyl)benzene