
CAS 1099597-65-5
:1-Chloro-2-(2,2,2-trifluoroethyl)-4-(trifluoromethyl)benzene
Description:
1-Chloro-2-(2,2,2-trifluoroethyl)-4-(trifluoromethyl)benzene is an organic compound characterized by its complex fluorinated structure, which includes a benzene ring substituted with both chloro and trifluoromethyl groups. The presence of the trifluoroethyl group enhances its lipophilicity and volatility, making it relevant in various chemical applications, including as a potential solvent or intermediate in organic synthesis. The compound's molecular structure contributes to its unique physical and chemical properties, such as high thermal stability and resistance to degradation. Additionally, the presence of multiple fluorine atoms typically imparts characteristics like low surface tension and high electronegativity, influencing its reactivity and interactions with other substances. Due to its specific functional groups, this compound may exhibit interesting behavior in terms of solubility and reactivity, particularly in reactions involving nucleophiles or electrophiles. Safety and handling precautions are essential due to the potential toxicity and environmental impact associated with fluorinated compounds.
Formula:C9H5ClF6
InChI:InChI=1S/C9H5ClF6/c10-7-2-1-6(9(14,15)16)3-5(7)4-8(11,12)13/h1-3H,4H2
InChI key:InChIKey=MCPYVWVVVRPGJK-UHFFFAOYSA-N
SMILES:C(C(F)(F)F)C1=CC(C(F)(F)F)=CC=C1Cl
Synonyms:- 1-Chloro-2-(2,2,2-trifluoroethyl)-4-(trifluoromethyl)benzene
- Benzene, 1-chloro-2-(2,2,2-trifluoroethyl)-4-(trifluoromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.