CymitQuimica logo

CAS 1099597-69-9

:

1-Methyl-2-(3,3,3-trifluoropropyl)benzene

Description:
1-Methyl-2-(3,3,3-trifluoropropyl)benzene, identified by its CAS number 1099597-69-9, is an organic compound characterized by a benzene ring substituted with a methyl group and a trifluoropropyl group. This compound features a hydrophobic aromatic structure, which contributes to its potential applications in various chemical processes and materials. The presence of the trifluoropropyl group introduces significant fluorine content, enhancing its chemical stability and altering its physical properties, such as boiling point and solubility. The trifluoromethyl groups can also impart unique electronic characteristics, making the compound of interest in fields like materials science and pharmaceuticals. Additionally, the compound's structure suggests it may exhibit interesting interactions with other chemical species, potentially influencing its reactivity and behavior in different environments. Overall, 1-Methyl-2-(3,3,3-trifluoropropyl)benzene is a notable compound due to its unique structural features and potential applications in various industrial and research settings.
Formula:C10H11F3
InChI:InChI=1S/C10H11F3/c1-8-4-2-3-5-9(8)6-7-10(11,12)13/h2-5H,6-7H2,1H3
InChI key:InChIKey=LRBCKWUXIUDRHH-UHFFFAOYSA-N
SMILES:C(CC(F)(F)F)C1=C(C)C=CC=C1
Synonyms:
  • 1-Methyl-2-(3,3,3-trifluoropropyl)benzene
  • Benzene, 1-methyl-2-(3,3,3-trifluoropropyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.