
CAS 1099597-73-5
:1-Methyl-4-(3,3,3-trifluoropropyl)benzene
Description:
1-Methyl-4-(3,3,3-trifluoropropyl)benzene, with the CAS number 1099597-73-5, is an organic compound characterized by a benzene ring substituted with a methyl group and a trifluoropropyl group. This compound features a hydrophobic aromatic structure due to the benzene ring, which contributes to its stability and potential applications in various chemical processes. The presence of the trifluoropropyl group introduces significant fluorine content, which can enhance the compound's chemical resistance and alter its physical properties, such as boiling point and solubility. The trifluoromethyl groups are known for their electron-withdrawing effects, which can influence the reactivity of the compound in electrophilic aromatic substitution reactions. Additionally, the compound may exhibit unique interactions with biological systems, making it of interest in fields such as pharmaceuticals and materials science. Overall, 1-Methyl-4-(3,3,3-trifluoropropyl)benzene is a versatile compound with potential applications in various industrial and research settings.
Formula:C10H11F3
InChI:InChI=1S/C10H11F3/c1-8-2-4-9(5-3-8)6-7-10(11,12)13/h2-5H,6-7H2,1H3
InChI key:InChIKey=ALHJMSLGDLXEPG-UHFFFAOYSA-N
SMILES:C(CC(F)(F)F)C1=CC=C(C)C=C1
Synonyms:- 1-Methyl-4-(3,3,3-trifluoropropyl)benzene
- 4-[2-(Trifluoromethyl)ethyl]toluene
- Benzene, 1-methyl-4-(3,3,3-trifluoropropyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.