CAS 1099597-84-8

1,3,5-Trimethyl-2-(2,2,2-trifluoroethyl)benzene

Description:

1,3,5-Trimethyl-2-(2,2,2-trifluoroethyl)benzene is an organic compound characterized by its aromatic structure, featuring a benzene ring substituted with three methyl groups and a trifluoroethyl group. The presence of the trifluoroethyl group imparts unique properties, such as increased hydrophobicity and potential volatility, due to the electronegative fluorine atoms. This compound is likely to exhibit a non-polar character, making it less soluble in water but soluble in organic solvents. Its molecular structure suggests potential applications in various fields, including materials science and pharmaceuticals, where fluorinated compounds are often valued for their stability and unique reactivity. Additionally, the presence of multiple methyl groups can influence the compound's boiling point and melting point, typically resulting in a higher boiling point compared to non-substituted benzene derivatives. Safety data regarding its handling and potential toxicity would be essential for practical applications, as with many fluorinated compounds, due to environmental and health considerations.

Formula: C₁₁H₁₃F₃

InChI: InChI=1S/C11H13F3/c1-7-4-8(2)10(9(3)5-7)6-11(12,13)14/h4-5H,6H2,1-3H3

InChI key: InChIKey=RYZANYPGDKSQAZ-UHFFFAOYSA-N

SMILES: C(C(F)(F)F)C1=C(C)C=C(C)C=C1C

Synonyms:

• 1,3,5-Trimethyl-2-(2,2,2-trifluoroethyl)benzene
• Benzene, 1,3,5-trimethyl-2-(2,2,2-trifluoroethyl)-