CymitQuimica logo

CAS 1099597-85-9

:

1,2-Difluoro-3-(2,2,2-trifluoroethyl)benzene

Description:
1,2-Difluoro-3-(2,2,2-trifluoroethyl)benzene is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with two fluorine atoms and a trifluoroethyl group. The presence of fluorine atoms contributes to its unique chemical properties, such as increased lipophilicity and thermal stability. This compound is likely to exhibit low volatility and high resistance to degradation, making it suitable for various applications in the chemical industry, particularly in the development of fluorinated materials. Its molecular structure suggests potential uses in pharmaceuticals, agrochemicals, or as a solvent in specialized applications. Additionally, the trifluoroethyl group can enhance the compound's reactivity and solubility in nonpolar solvents. Safety considerations are important due to the presence of fluorine, which can pose environmental and health risks. Overall, 1,2-Difluoro-3-(2,2,2-trifluoroethyl)benzene is a fluorinated aromatic compound with distinctive properties that make it valuable in various chemical applications.
Formula:C8H5F5
InChI:InChI=1S/C8H5F5/c9-6-3-1-2-5(7(6)10)4-8(11,12)13/h1-3H,4H2
InChI key:InChIKey=VAYWNVMYEGXERX-UHFFFAOYSA-N
SMILES:C(C(F)(F)F)C1=C(F)C(F)=CC=C1
Synonyms:
  • 1,2-Difluoro-3-(2,2,2-trifluoroethyl)benzene
  • Benzene, 1,2-difluoro-3-(2,2,2-trifluoroethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.