
CAS 1099597-87-1
:2,3-Bis(trifluoromethyl)-1,8-naphthyridine
Description:
2,3-Bis(trifluoromethyl)-1,8-naphthyridine is a heterocyclic organic compound characterized by its naphthyridine structure, which consists of a fused bicyclic system containing nitrogen atoms. The presence of two trifluoromethyl groups (-CF3) at the 2 and 3 positions significantly influences its chemical properties, enhancing its lipophilicity and stability. This compound is typically a solid at room temperature and exhibits high thermal stability due to the strong C-F bonds. Its unique electronic properties, derived from the electron-withdrawing trifluoromethyl groups, make it a candidate for various applications in medicinal chemistry and materials science. The compound may also exhibit interesting biological activities, although specific biological data would depend on empirical studies. Additionally, its synthesis and reactivity can be influenced by the presence of the nitrogen atoms in the naphthyridine ring, which can participate in various chemical reactions, including nucleophilic substitutions and coordination with metal ions. Overall, 2,3-Bis(trifluoromethyl)-1,8-naphthyridine is a compound of interest for research and development in multiple fields.
Formula:C10H4F6N2
InChI:InChI=1S/C10H4F6N2/c11-9(12,13)6-4-5-2-1-3-17-8(5)18-7(6)10(14,15)16/h1-4H
InChI key:InChIKey=MEHLMXOENZGXNR-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1C(C(F)(F)F)=NC2=C(C1)C=CC=N2
Synonyms:- 2,3-Bis(trifluoromethyl)-1,8-naphthyridine
- 1,8-Naphthyridine, 2,3-bis(trifluoromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.