CAS 1099597-90-6

1-(2,2,2-Trifluoroethyl)-2,4-bis(trifluoromethyl)benzene

Description:

1-(2,2,2-Trifluoroethyl)-2,4-bis(trifluoromethyl)benzene, identified by its CAS number 1099597-90-6, is a fluorinated aromatic compound characterized by the presence of multiple trifluoromethyl groups and a trifluoroethyl substituent. This structure imparts significant hydrophobicity and lipophilicity, making it less soluble in water but more soluble in organic solvents. The trifluoromethyl groups enhance the compound's thermal stability and chemical resistance, which can be advantageous in various applications, including as a potential intermediate in the synthesis of pharmaceuticals or agrochemicals. Additionally, the presence of fluorine atoms can influence the compound's electronic properties, potentially affecting its reactivity and interaction with biological systems. Due to its unique characteristics, this compound may also exhibit interesting properties in materials science, particularly in the development of fluorinated polymers or coatings. However, the environmental and health impacts of such fluorinated compounds should be carefully considered, given the persistence of fluorinated substances in the environment.

Formula: C₁₀H₅F₉

InChI: InChI=1S/C10H5F9/c11-8(12,13)4-5-1-2-6(9(14,15)16)3-7(5)10(17,18)19/h1-3H,4H2

InChI key: InChIKey=IYPFSMLQVWRPFV-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C1=C(CC(F)(F)F)C=CC(C(F)(F)F)=C1

Synonyms:

• Benzene, 1-(2,2,2-trifluoroethyl)-2,4-bis(trifluoromethyl)-
• 1-(2,2,2-Trifluoroethyl)-2,4-bis(trifluoromethyl)benzene