CAS 1099597-91-7

1-(1,1-Difluoro-2-methylpropyl)-4-fluorobenzene

Description:

1-(1,1-Difluoro-2-methylpropyl)-4-fluorobenzene, with the CAS number 1099597-91-7, is an organic compound characterized by its unique structure, which includes a fluorinated aromatic ring and a branched alkyl group. The presence of multiple fluorine atoms contributes to its chemical stability and influences its physical properties, such as boiling and melting points. This compound is likely to exhibit hydrophobic characteristics due to the fluorinated groups, making it less soluble in water but potentially soluble in organic solvents. Its molecular structure suggests potential applications in various fields, including pharmaceuticals and agrochemicals, where fluorinated compounds are often valued for their biological activity and metabolic stability. Additionally, the presence of the difluoromethyl group may enhance its reactivity in certain chemical reactions, making it a subject of interest in synthetic organic chemistry. Overall, the compound's unique fluorinated structure and potential applications make it a noteworthy subject for further research and exploration in chemical sciences.

Formula: C₁₀H₁₁F₃

InChI: InChI=1S/C10H11F3/c1-7(2)10(12,13)8-3-5-9(11)6-4-8/h3-7H,1-2H3

InChI key: InChIKey=ONXMNXDJNYBQSU-UHFFFAOYSA-N

SMILES: C(C(C)C)(F)(F)C1=CC=C(F)C=C1

Synonyms:

• 1-(1,1-Difluoro-2-methylpropyl)-4-fluorobenzene
• Benzene, 1-(1,1-difluoro-2-methylpropyl)-4-fluoro-