
CAS 1099598-03-4
:1-Fluoro-4-(5,5,5-trifluoropentyl)benzene
Description:
1-Fluoro-4-(5,5,5-trifluoropentyl)benzene is an organic compound characterized by a benzene ring substituted with a fluorine atom and a trifluoropentyl group. The presence of the fluorine atom enhances the compound's lipophilicity and can influence its reactivity and interaction with biological systems. The trifluoropentyl group, consisting of a five-carbon chain with three fluorine atoms attached to the terminal carbon, contributes to the compound's overall hydrophobicity and stability. This structure may impart unique properties such as increased thermal stability and resistance to degradation. The compound is likely to be a colorless to pale yellow liquid or solid, depending on its specific form and purity. Its applications may span various fields, including pharmaceuticals, agrochemicals, and materials science, particularly in the development of fluorinated compounds that exhibit desirable characteristics such as low surface tension and high chemical stability. Safety data should be consulted for handling and exposure guidelines, as fluorinated compounds can exhibit varying degrees of toxicity and environmental impact.
Formula:C11H12F4
InChI:InChI=1S/C11H12F4/c12-10-6-4-9(5-7-10)3-1-2-8-11(13,14)15/h4-7H,1-3,8H2
InChI key:InChIKey=ZDNVDNUPMPJJTI-UHFFFAOYSA-N
SMILES:C(CCCC(F)(F)F)C1=CC=C(F)C=C1
Synonyms:- Benzene, 1-fluoro-4-(5,5,5-trifluoropentyl)-
- 1-Fluoro-4-(5,5,5-trifluoropentyl)benzene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.