CymitQuimica logo

CAS 1099598-06-7

:

2-Bromo-1,1,1,3-tetrafluoro-3-methylbutane

Description:
2-Bromo-1,1,1,3-tetrafluoro-3-methylbutane is a halogenated organic compound characterized by its unique structure, which includes a bromine atom and multiple fluorine substituents on a branched alkane backbone. This compound features a tetrafluorinated carbon, which significantly influences its physical and chemical properties, such as increased stability and lower reactivity compared to non-fluorinated hydrocarbons. The presence of the bromine atom introduces a polar functional group, enhancing its potential for various chemical reactions, including nucleophilic substitutions. Its molecular structure contributes to its relatively low volatility and high density, making it useful in specific applications, including as a solvent or in the synthesis of other chemical compounds. Additionally, the compound's fluorinated nature may impart unique thermal and chemical resistance, making it suitable for specialized industrial applications. Safety considerations are essential when handling this substance due to the potential environmental and health impacts associated with halogenated compounds.
Formula:C5H7BrF4
InChI:InChI=1S/C5H7BrF4/c1-4(2,7)3(6)5(8,9)10/h3H,1-2H3
InChI key:InChIKey=QPOXETOPFSJYBI-UHFFFAOYSA-N
SMILES:C(C(C)(C)F)(C(F)(F)F)Br
Synonyms:
  • 2-Bromo-1,1,1,3-tetrafluoro-3-methylbutane
  • Butane, 2-bromo-1,1,1,3-tetrafluoro-3-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.