
CAS 1099598-10-3
:4-(2,2,2-Trifluoroethyl)pyridine
Description:
4-(2,2,2-Trifluoroethyl)pyridine is an organic compound characterized by the presence of a pyridine ring substituted with a trifluoroethyl group at the 4-position. This compound features a six-membered aromatic ring containing one nitrogen atom, which contributes to its basicity and potential for forming coordination complexes. The trifluoroethyl group enhances the compound's lipophilicity and can influence its reactivity and solubility in various solvents. Due to the presence of fluorine atoms, it exhibits unique electronic properties, making it of interest in medicinal chemistry and materials science. The compound may also demonstrate specific interactions with biological targets, which can be explored for pharmaceutical applications. Additionally, its stability and reactivity can be affected by the electronic effects of the trifluoroethyl group, making it a valuable candidate for further research in synthetic chemistry and drug development. Safety data and handling precautions should be considered, as with any chemical substance, to ensure proper laboratory practices.
Formula:C7H6F3N
InChI:InChI=1S/C7H6F3N/c8-7(9,10)5-6-1-3-11-4-2-6/h1-4H,5H2
InChI key:InChIKey=DBSQQZWLFKXCRU-UHFFFAOYSA-N
SMILES:C(C(F)(F)F)C=1C=CN=CC1
Synonyms:- Pyridine, 4-(2,2,2-trifluoroethyl)-
- 4-(2,2,2-Trifluoroethyl)pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.