CymitQuimica logo

CAS 1099598-12-5

:

1,1′-[3-Bromo-1-(trifluoromethyl)propylidene]bis[benzene]

Description:
1,1′-[3-Bromo-1-(trifluoromethyl)propylidene]bis[benzene], identified by its CAS number 1099598-12-5, is an organic compound characterized by its complex structure featuring a bis(benzene) moiety linked by a propylidene group that includes a bromine atom and a trifluoromethyl group. This compound exhibits significant hydrophobic characteristics due to the presence of multiple aromatic rings, which contribute to its stability and potential for π-π stacking interactions. The trifluoromethyl group enhances its lipophilicity and can influence its reactivity and interaction with biological systems. Additionally, the bromine substituent may impart unique electrophilic properties, making it a candidate for various chemical reactions, including nucleophilic substitutions. The compound's unique structural features suggest potential applications in materials science, pharmaceuticals, or as an intermediate in organic synthesis. However, specific physical properties such as melting point, boiling point, and solubility would require empirical data for precise characterization. Overall, this compound represents a fascinating example of halogenated aromatic chemistry.
Formula:C16H14BrF3
InChI:InChI=1S/C16H14BrF3/c17-12-11-15(16(18,19)20,13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-10H,11-12H2
InChI key:InChIKey=FKVYBVCCNZHWCL-UHFFFAOYSA-N
SMILES:C(C(F)(F)F)(CCBr)(C1=CC=CC=C1)C2=CC=CC=C2
Synonyms:
  • 1,1′-[3-Bromo-1-(trifluoromethyl)propylidene]bis[benzene]
  • Benzene, 1,1′-[3-bromo-1-(trifluoromethyl)propylidene]bis-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.