
CAS 1099598-17-0
:[1-(Trifluoromethyl)pentyl]cyclopentane
Description:
[1-(Trifluoromethyl)pentyl]cyclopentane is an organic compound characterized by its unique structure, which includes a cyclopentane ring and a pentyl chain substituted with a trifluoromethyl group. This compound is notable for its fluorinated alkyl group, which can significantly influence its physical and chemical properties, such as volatility, solubility, and reactivity. The presence of the trifluoromethyl group typically enhances the compound's hydrophobicity and can impart unique electronic characteristics, making it of interest in various chemical applications, including pharmaceuticals and agrochemicals. The cyclopentane moiety contributes to the compound's overall stability and can affect its conformational flexibility. Additionally, the compound may exhibit interesting interactions with biological systems due to its fluorinated nature. As with many fluorinated compounds, it is essential to consider environmental and health implications, as some fluorinated substances can persist in the environment and may have specific regulatory considerations. Overall, [1-(Trifluoromethyl)pentyl]cyclopentane represents a class of compounds that combine structural complexity with potential utility in various fields of chemistry.
Formula:C11H19F3
InChI:InChI=1S/C11H19F3/c1-2-3-8-10(11(12,13)14)9-6-4-5-7-9/h9-10H,2-8H2,1H3
InChI key:InChIKey=ZUICBPKRTOLBQX-UHFFFAOYSA-N
SMILES:C(CCCC)(C(F)(F)F)C1CCCC1
Synonyms:- Cyclopentane, [1-(trifluoromethyl)pentyl]-
- [1-(Trifluoromethyl)pentyl]cyclopentane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.