CAS 1099598-20-5: 1-Bromo-4-(2,2-difluoropropyl)benzene
Description:1-Bromo-4-(2,2-difluoropropyl)benzene is an organic compound characterized by the presence of a bromine atom and a difluoropropyl group attached to a benzene ring. The molecular structure features a bromine substituent at the para position relative to the difluoropropyl group, which consists of a three-carbon chain with two fluorine atoms attached to the second carbon. This compound is typically a colorless to pale yellow liquid and is known for its moderate volatility and potential reactivity due to the presence of the bromine atom, which can participate in nucleophilic substitution reactions. The difluoropropyl group contributes to the compound's unique physical and chemical properties, including its polarity and potential applications in various chemical syntheses. Additionally, the presence of fluorine atoms often enhances the compound's stability and lipophilicity, making it of interest in fields such as pharmaceuticals and agrochemicals. Safety data should be consulted for handling and storage, as halogenated compounds can pose environmental and health risks.
Formula:C9H9BrF2
InChI:InChI=1S/C9H9BrF2/c1-9(11,12)6-7-2-4-8(10)5-3-7/h2-5H,6H2,1H3
InChI key:InChIKey=VIEJQUIQUJATPR-UHFFFAOYSA-N
SMILES:FC(F)(C)CC1=CC=C(Br)C=C1
- Synonyms:
- Benzene, 1-bromo-4-(2,2-difluoropropyl)-
- 1-Bromo-4-(2,2-difluoropropyl)benzene
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 1-Bromo-4-(2,2-difluoropropyl)benzene REF: 54-PC520609CAS: 1099598-20-5 | 97% | To inquire | Mon 10 Mar 25 |
![]() | 1-Bromo-4-(2,2-difluoropropyl)benzene REF: 10-F754671CAS: 1099598-20-5 | 98% | - - - | Discontinued product |
![]() | 1-Bromo-4-(2,2-difluoropropyl)benzene REF: 3D-ZTB59820CAS: 1099598-20-5 | Min. 95% | - - - | Discontinued product |
![discount label](https://static.cymitquimica.com/public/img/discount.png)
Ref: 54-PC520609
Undefined size | To inquire |
![discount label](https://static.cymitquimica.com/public/img/discount.png)
Ref: 10-F754671
1g | Discontinued | Request information | |
5g | Discontinued | Request information |
![discount label](https://static.cymitquimica.com/public/img/discount.png)
1-Bromo-4-(2,2-difluoropropyl)benzene
Ref: 3D-ZTB59820
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
10g | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |