CAS 109960-17-0
:1H-Pyrrole-1-aceticacid,2,5-dimethyl-(9CI)
Description:
1H-Pyrrole-1-acetic acid, 2,5-dimethyl- (CAS 109960-17-0) is an organic compound characterized by its pyrrole ring structure, which is a five-membered aromatic heterocycle containing one nitrogen atom. This compound features an acetic acid functional group attached to the pyrrole, contributing to its acidic properties. The presence of two methyl groups at the 2 and 5 positions of the pyrrole ring enhances its hydrophobic character and may influence its reactivity and solubility in various solvents. Typically, compounds of this nature exhibit biological activity, making them of interest in medicinal chemistry and pharmacology. The molecular structure suggests potential interactions with biological targets, which could lead to applications in drug development. Additionally, the compound's stability and reactivity can be influenced by the electronic effects of the substituents on the pyrrole ring. Overall, 1H-Pyrrole-1-acetic acid, 2,5-dimethyl- is a compound of interest due to its unique structural features and potential applications in various fields of chemistry and biology.
Formula:C8H11NO2
InChI:InChI=1/C8H11NO2/c1-6-3-4-7(2)9(6)5-8(10)11/h3-4H,5H2,1-2H3,(H,10,11)
SMILES:Cc1ccc(C)n1CC(=O)O
Synonyms:- 2,5-Dimethylpyrrole-1-Aceticacid
- (2,5-dimethyl-1H-pyrrol-1-yl)acetic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
(2,5-Dimethyl-1H-pyrrol-1-yl)acetic acid
CAS:(2,5-Dimethyl-1H-pyrrol-1-yl)acetic acid is an amino acid that can be found in the human brain. It is an oxidation product of glycine, which is a neurotransmitter. (2,5-Dimethyl-1H-pyrrol-1-yl)acetic acid has been shown to play a role in the molecular mechanism of nerve cells and may have a role in nervous system atrophy. The precise function of this compound remains unclear at this time.
Formula:C8H11NO2Purity:Min. 95%Color and Shape:PowderMolecular weight:153.18 g/mol

