CAS 1099610-67-9
:Ethyl 3,5-dimethyl-1-piperidinepropanoate
Description:
Ethyl 3,5-dimethyl-1-piperidinepropanoate is an organic compound characterized by its piperidine ring structure, which is a six-membered ring containing one nitrogen atom. This compound features an ethyl ester functional group, indicating that it is derived from a carboxylic acid and an alcohol. The presence of two methyl groups at the 3 and 5 positions of the piperidine ring contributes to its steric and electronic properties, potentially influencing its reactivity and interactions with biological systems. Ethyl 3,5-dimethyl-1-piperidinepropanoate is likely to be a colorless to pale yellow liquid, exhibiting moderate solubility in organic solvents. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the piperidine moiety's prevalence in various bioactive compounds. As with many organic compounds, safety data should be consulted to understand its toxicity and handling requirements.
Formula:C12H23NO2
InChI:InChI=1S/C12H23NO2/c1-4-15-12(14)5-6-13-8-10(2)7-11(3)9-13/h10-11H,4-9H2,1-3H3
InChI key:InChIKey=IDIXQDLEKMHRAK-UHFFFAOYSA-N
SMILES:C(CC(OCC)=O)N1CC(C)CC(C)C1
Synonyms:- Ethyl 3,5-dimethyl-1-piperidinepropanoate
- 1-Piperidinepropanoic acid, 3,5-dimethyl-, ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.