CAS 1099632-52-6

2,4,6-Triiodobenzenesulfonamide

Description:

2,4,6-Triiodobenzenesulfonamide is a chemical compound characterized by the presence of three iodine atoms attached to a benzene ring, along with a sulfonamide functional group. This compound is typically a solid at room temperature and is known for its potential applications in medicinal chemistry, particularly as an antimicrobial agent. The presence of iodine enhances its biological activity and can influence its solubility and reactivity. The sulfonamide group contributes to its ability to interact with biological systems, often mimicking the structure of para-aminobenzoic acid, which is essential for bacterial growth. The compound's molecular structure suggests it may exhibit unique electronic properties due to the electron-withdrawing nature of the iodine atoms, which can affect its reactivity and stability. Additionally, 2,4,6-Triiodobenzenesulfonamide may be subject to specific handling and storage requirements due to its potential toxicity and environmental impact. Overall, its unique structural features make it a compound of interest in various fields, including pharmaceuticals and materials science.

Formula: C₆H₄I₃NO₂S

InChI: InChI=1S/C6H4I3NO2S/c7-3-1-4(8)6(5(9)2-3)13(10,11)12/h1-2H,(H2,10,11,12)

InChI key: InChIKey=CUFKYWMIEZOSOX-UHFFFAOYSA-N

SMILES: S(N)(=O)(=O)C1=C(I)C=C(I)C=C1I

Synonyms:

• Benzenesulfonamide, 2,4,6-triiodo-
• 2,4,6-Triiodobenzenesulfonamide