CAS 1099632-72-0

2-(1H-1,2,4-Triazol-1-yl)benzenesulfonamide

Description:

2-(1H-1,2,4-Triazol-1-yl)benzenesulfonamide is a chemical compound characterized by its triazole and sulfonamide functional groups. This compound features a triazole ring, which is a five-membered heterocyclic structure containing three nitrogen atoms, contributing to its potential biological activity. The sulfonamide group, characterized by the presence of a sulfonyl (SO2) moiety attached to an amine, enhances its solubility and reactivity. This compound is often studied for its pharmacological properties, particularly in the context of antimicrobial and antifungal activities. Its structural features may allow for interactions with various biological targets, making it of interest in medicinal chemistry. Additionally, the presence of the benzene ring provides stability and influences the compound's electronic properties. Overall, 2-(1H-1,2,4-Triazol-1-yl)benzenesulfonamide is a versatile compound with potential applications in drug development and research.

Formula: C₈H₈N₄O₂S

InChI: InChI=1S/C8H8N4O2S/c9-15(13,14)8-4-2-1-3-7(8)12-6-10-5-11-12/h1-6H,(H2,9,13,14)

InChI key: InChIKey=PJWBFWSNXJPCSS-UHFFFAOYSA-N

SMILES: S(N)(=O)(=O)C1=C(C=CC=C1)N2C=NC=N2

Synonyms:

• 2-(1H-1,2,4-Triazol-1-yl)benzenesulfonamide
• Benzenesulfonamide, 2-(1H-1,2,4-triazol-1-yl)-