CAS 1099660-65-7

2,6-Dibromo-4-nitrobenzenesulfonamide

Description:

2,6-Dibromo-4-nitrobenzenesulfonamide is an organic compound characterized by the presence of bromine, nitro, and sulfonamide functional groups attached to a benzene ring. This compound features two bromine atoms located at the 2 and 6 positions, and a nitro group at the 4 position, which contributes to its reactivity and potential applications in various chemical processes. The sulfonamide group enhances its solubility in polar solvents and can influence its biological activity, making it of interest in medicinal chemistry. The presence of multiple halogen atoms and a nitro group suggests that this compound may exhibit significant electrophilic properties, which can be exploited in synthetic organic chemistry. Additionally, the compound's structure may impart specific physical properties, such as melting point and solubility, which are important for its handling and application in research. Overall, 2,6-Dibromo-4-nitrobenzenesulfonamide is a versatile compound with potential uses in pharmaceuticals and agrochemicals, although safety and environmental considerations should be taken into account due to the presence of halogens and nitro groups.

Formula: C₆H₄Br₂N₂O₄S

InChI: InChI=1S/C6H4Br2N2O4S/c7-4-1-3(10(11)12)2-5(8)6(4)15(9,13)14/h1-2H,(H2,9,13,14)

InChI key: InChIKey=SKNBINLPTNMREZ-UHFFFAOYSA-N

SMILES: S(N)(=O)(=O)C1=C(Br)C=C(N(=O)=O)C=C1Br

Synonyms:

• Benzenesulfonamide, 2,6-dibromo-4-nitro-
• 2,6-Dibromo-4-nitrobenzenesulfonamide