CAS 1099660-68-0

2H-Indazole-7-sulfonyl chloride

Description:

2H-Indazole-7-sulfonyl chloride is a chemical compound characterized by its indazole core structure, which is a bicyclic compound containing a five-membered ring fused to a six-membered ring. The sulfonyl chloride functional group (-SO2Cl) is attached at the 7-position of the indazole ring, making it a sulfonamide derivative. This compound is typically used in organic synthesis, particularly in the preparation of sulfonamide derivatives and as a reagent in various chemical reactions. It is known for its reactivity due to the presence of the sulfonyl chloride group, which can undergo nucleophilic substitution reactions with amines, alcohols, and other nucleophiles. The compound is generally handled with care due to its potential to release hydrochloric acid upon hydrolysis, and it may pose hazards such as skin and respiratory irritation. As with many sulfonyl chlorides, it is important to store it in a cool, dry place and use appropriate personal protective equipment when handling.

Formula: C₇H₅ClN₂O₂S

InChI: InChI=1S/C7H5ClN2O2S/c8-13(11,12)6-3-1-2-5-4-9-10-7(5)6/h1-4H,(H,9,10)

InChI key: InChIKey=IMDFCHAVWXVYHC-UHFFFAOYSA-N

SMILES: S(Cl)(=O)(=O)C=1C=2C(C=CC1)=CNN2

Synonyms:

• 2H-Indazole-7-sulfonyl chloride