CAS 1099660-77-1

4-(2-Thiazolyl)benzenesulfonamide

Description:

4-(2-Thiazolyl)benzenesulfonamide is a chemical compound characterized by its thiazole and sulfonamide functional groups. The thiazole ring, a five-membered heterocycle containing sulfur and nitrogen, contributes to the compound's biological activity and potential pharmacological properties. The sulfonamide group, which features a sulfur atom bonded to two oxygen atoms and a nitrogen atom, is known for its role in medicinal chemistry, particularly in the development of antibacterial agents. This compound may exhibit properties such as solubility in polar solvents, moderate stability under standard conditions, and potential reactivity with nucleophiles due to the presence of the sulfonamide moiety. Its structural features suggest possible applications in drug development, particularly in targeting specific biological pathways. Additionally, the presence of the thiazole ring may enhance its interaction with biological targets, making it a candidate for further research in medicinal chemistry and related fields. As with any chemical substance, safety and handling precautions should be observed, and its properties should be evaluated in the context of specific applications.

Formula: C₉H₈N₂O₂S₂

InChI: InChI=1S/C9H8N2O2S2/c10-15(12,13)8-3-1-7(2-4-8)9-11-5-6-14-9/h1-6H,(H2,10,12,13)

InChI key: InChIKey=OFXHFOFJYPSEIJ-UHFFFAOYSA-N

SMILES: S(N)(=O)(=O)C1=CC=C(C=C1)C2=NC=CS2

Synonyms:

• Benzenesulfonamide, 4-(2-thiazolyl)-
• 4-(2-Thiazolyl)benzenesulfonamide