
CAS 1099660-82-8
:Methyl 5-(aminosulfonyl)-2,4-difluorobenzoate
Description:
Methyl 5-(aminosulfonyl)-2,4-difluorobenzoate is a chemical compound characterized by its unique structure, which includes a benzoate moiety substituted with both amino and sulfonyl groups, as well as difluorine atoms. This compound typically exhibits properties associated with both aromatic and aliphatic systems, including potential solubility in polar solvents due to the presence of the sulfonamide group. The difluorination introduces significant electronegativity, which can influence the compound's reactivity and interaction with biological targets. Methyl 5-(aminosulfonyl)-2,4-difluorobenzoate may be of interest in medicinal chemistry, particularly for its potential applications in drug development, as the presence of fluorine can enhance metabolic stability and bioavailability. Additionally, the sulfonamide functional group is known for its biological activity, often serving as a pharmacophore in various therapeutic agents. Overall, this compound's distinctive functional groups and structural features make it a subject of interest in both synthetic and medicinal chemistry research.
Formula:C8H7F2NO4S
InChI:InChI=1S/C8H7F2NO4S/c1-15-8(12)4-2-7(16(11,13)14)6(10)3-5(4)9/h2-3H,1H3,(H2,11,13,14)
InChI key:InChIKey=AYMWEEBATUNNOZ-UHFFFAOYSA-N
SMILES:S(N)(=O)(=O)C1=CC(C(OC)=O)=C(F)C=C1F
Synonyms:- Benzoic acid, 5-(aminosulfonyl)-2,4-difluoro-, methyl ester
- Methyl 5-(aminosulfonyl)-2,4-difluorobenzoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.