CAS 1099660-85-1

Methyl 3-(aminosulfonyl)-2-methylbenzoate

Description:

Methyl 3-(aminosulfonyl)-2-methylbenzoate, identified by its CAS number 1099660-85-1, is an organic compound characterized by the presence of a benzoate structure with a methyl group and an aminosulfonyl substituent. This compound typically exhibits properties associated with both aromatic and sulfonamide functionalities, which can influence its solubility, reactivity, and biological activity. The presence of the methyl group enhances its hydrophobic characteristics, while the aminosulfonyl group introduces polar characteristics, potentially allowing for hydrogen bonding and interactions with biological targets. Methyl 3-(aminosulfonyl)-2-methylbenzoate may be utilized in various chemical syntheses or as an intermediate in pharmaceutical applications, particularly due to the sulfonamide moiety, which is known for its antibacterial properties. Its stability, melting point, and specific reactivity would depend on the surrounding conditions and the presence of other functional groups in a given reaction environment. As with many organic compounds, safety data and handling precautions should be considered when working with this substance.

Formula: C₉H₁₁NO₄S

InChI: InChI=1S/C9H11NO4S/c1-6-7(9(11)14-2)4-3-5-8(6)15(10,12)13/h3-5H,1-2H3,(H2,10,12,13)

InChI key: InChIKey=IHNXZDSLZOGBJO-UHFFFAOYSA-N

SMILES: S(N)(=O)(=O)C1=C(C)C(C(OC)=O)=CC=C1

Synonyms:

• Benzoic acid, 3-(aminosulfonyl)-2-methyl-, methyl ester
• Methyl 3-(aminosulfonyl)-2-methylbenzoate
• Methyl 2-methyl-3-sulfamoylbenzoate