
CAS 1099665-56-1
:2-Fluorobenzeneethanethiol
Description:
2-Fluorobenzeneethanethiol, also known as 2-fluorobenzenethanethiol, is an organofluorine compound characterized by the presence of a thiol (-SH) group attached to a benzene ring that also contains a fluorine atom in the ortho position relative to the thiol group. This compound typically exhibits a colorless to pale yellow liquid form and possesses a distinctive odor due to the thiol functional group. The presence of the fluorine atom can influence the compound's reactivity and polarity, potentially enhancing its solubility in polar solvents. 2-Fluorobenzeneethanethiol may participate in various chemical reactions, including nucleophilic substitutions and thiol-related reactions, making it of interest in organic synthesis and materials science. Its unique properties may also lend it applications in pharmaceuticals, agrochemicals, and as a building block in the synthesis of more complex molecules. Safety precautions should be observed when handling this compound, as thiols can be toxic and have strong odors.
Formula:C8H9FS
InChI:InChI=1S/C8H9FS/c9-8-4-2-1-3-7(8)5-6-10/h1-4,10H,5-6H2
InChI key:InChIKey=CYVNGKCGAUOWLV-UHFFFAOYSA-N
SMILES:C(CS)C1=C(F)C=CC=C1
Synonyms:- 2-Fluorobenzeneethanethiol
- Benzeneethanethiol, 2-fluoro-
- 2-(2-Fluorophenyl)ethane-1-thiol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.