
CAS 109971-40-6
:Boronic acid, [4-[2-[(1-methylethyl)amino]propyl]phenyl]-
Description:
Boronic acid, specifically the compound with the name "4-[2-[(1-methylethyl)amino]propyl]phenyl]boronic acid" and CAS number 109971-40-6, is an organoboron compound characterized by the presence of a boronic acid functional group (-B(OH)2) attached to a phenyl ring. This compound typically exhibits properties such as moderate solubility in polar solvents and can participate in various chemical reactions, including Suzuki coupling, which is significant in organic synthesis and medicinal chemistry. The presence of the isopropylamino group enhances its potential as a ligand in coordination chemistry and may influence its biological activity. Boronic acids are known for their ability to form reversible covalent bonds with diols, making them useful in sensor applications and drug design. Additionally, this compound may exhibit unique reactivity patterns due to the steric and electronic effects imparted by the substituents on the aromatic ring and the amino group. Overall, boronic acids are versatile intermediates in synthetic chemistry with applications spanning pharmaceuticals, materials science, and catalysis.
Formula:C12H20BNO2
InChI:InChI=1S/C12H20BNO2/c1-9(2)14-10(3)8-11-4-6-12(7-5-11)13(15)16/h4-7,9-10,14-16H,8H2,1-3H3
InChI key:InChIKey=DCCHCLPZXAHCQJ-UHFFFAOYSA-N
SMILES:C(C(NC(C)C)C)C1=CC=C(B(O)O)C=C1
Synonyms:- [4-[2-(Propan-2-ylamino)propyl]phenyl]boronic acid
- (4-[2-[(Propan-2-yl)amino]propyl]phenyl)boronic acid
- Boronic acid, [4-[2-[(1-methylethyl)amino]propyl]phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Boronic acid, [4-[2-[(1-methylethyl)amino]propyl]phenyl]-
CAS:Formula:C12H20BNO2Molecular weight:221.1037
