CymitQuimica logo

CAS 109976-36-5

:

γ-Hydroxy-2-furanbutanal

Description:
γ-Hydroxy-2-furanbutanal, with the CAS number 109976-36-5, is an organic compound characterized by its furan ring and aldehyde functional group. This compound features a hydroxyl group (-OH) attached to the gamma position of a butanal chain, which contributes to its reactivity and potential applications in organic synthesis. It is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. The presence of the furan ring imparts unique chemical properties, making it a valuable intermediate in the synthesis of various pharmaceuticals and agrochemicals. Its structure allows for potential hydrogen bonding, influencing its solubility and interaction with other molecules. Additionally, γ-Hydroxy-2-furanbutanal may exhibit biological activity, which could be explored for therapeutic uses. As with many organic compounds, handling should be done with care, considering safety data and potential hazards associated with its use.
Formula:C8H10O3
InChI:InChI=1S/C8H10O3/c9-5-1-3-7(10)8-4-2-6-11-8/h2,4-7,10H,1,3H2
InChI key:InChIKey=ACLCSTSQPKWNEX-UHFFFAOYSA-N
SMILES:C(CCC=O)(O)C1=CC=CO1
Synonyms:
  • γ-Hydroxy-2-furanbutanal
  • 2-Furanbutanal, γ-hydroxy-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.