CAS 109995-82-6

4,4′-(4,4-Diphenyl-1,3-butadien-1-ylidene)bis[N,N-diethylbenzenamine]

Description:

4,4′-(4,4-Diphenyl-1,3-butadien-1-ylidene)bis[N,N-diethylbenzenamine], identified by its CAS number 109995-82-6, is an organic compound characterized by its complex structure featuring a central butadiene moiety flanked by two N,N-diethylbenzenamine groups. This compound typically exhibits properties associated with organic dyes or pigments, including vibrant coloration and potential applications in materials science, particularly in organic electronics and photonics. Its molecular structure suggests significant conjugation, which can lead to interesting optical properties such as fluorescence or phosphorescence. The presence of the diphenyl and diethyl groups may influence its solubility, stability, and reactivity, making it suitable for various chemical applications. Additionally, the compound's synthesis and behavior in different solvents can provide insights into its potential uses in dye-sensitized solar cells or as a fluorescent marker in biological systems. Overall, this compound represents a fascinating area of study within organic chemistry, particularly in the context of functional materials.

Formula: C₃₆H₄₀N₂

InChI: InChI=1S/C36H40N2/c1-5-37(6-2)33-23-19-31(20-24-33)36(32-21-25-34(26-22-32)38(7-3)8-4)28-27-35(29-15-11-9-12-16-29)30-17-13-10-14-18-30/h9-28H,5-8H2,1-4H3

InChI key: InChIKey=MNEPURVJQJNPQW-UHFFFAOYSA-N

SMILES: C(=CC=C(C1=CC=CC=C1)C2=CC=CC=C2)(C3=CC=C(N(CC)CC)C=C3)C4=CC=C(N(CC)CC)C=C4

Synonyms:

• 4,4′-(4,4-Diphenyl-1,3-butadien-1-ylidene)bis[N,N-diethylbenzenamine]
• 4,4'-(4,4-diphenylbuta-1,3-diene-1,1-diyl)bis(N,N-diethylaniline)
• Benzenamine, 4,4′-(4,4-diphenyl-1,3-butadien-1-ylidene)bis[N,N-diethyl-
• 1,1-Bis(4-diethylaminophenyl)-4,4-diphenyl-1,3-butadiene
• 1,1-Bis(p-diethylaminophenyl)-4,4-diphenyl-1,3-butadiene
• Benzenamine, 4,4′-(4,4-diphenyl-1,3-butadienylidene)bis[N,N-diethyl-