CAS 110-03-2: 2,5-Dimethyl-2,5-hexanediol
Description:2,5-Dimethyl-2,5-hexanediol, with the CAS number 110-03-2, is an organic compound characterized by its structure, which features two hydroxyl (-OH) groups attached to a hexane backbone that is further substituted with two methyl groups. This diol is a colorless, viscous liquid at room temperature and is known for its hygroscopic nature, meaning it can absorb moisture from the air. It has a relatively high boiling point and low volatility, making it suitable for various applications, including as a solvent and in the formulation of coatings and plastics. The presence of hydroxyl groups contributes to its ability to participate in hydrogen bonding, enhancing its solubility in polar solvents. Additionally, 2,5-Dimethyl-2,5-hexanediol exhibits moderate toxicity, and safety precautions should be taken when handling it. Its unique properties make it valuable in chemical synthesis and industrial applications, particularly in the production of polyurethanes and other polymeric materials.
Formula:C8H18O2
InChI:InChI=1S/C8H18O2/c1-7(2,9)5-6-8(3,4)10/h9-10H,5-6H2,1-4H3
InChI key:InChIKey=ZWNMRZQYWRLGMM-UHFFFAOYSA-N
SMILES:OC(C)(C)CCC(O)(C)C
- Synonyms:
- 1,1,4,4-Tetramethyl-1,4-butanediol
- 2,5-Dihydroxy-2,5-dimethylhexane
- 2,5-Dimethyl-2,5-Hexandiol
- 2,5-Dimethylhexane-2,5-Diol
- 2,5-Hexanediol, 2,5-dimethyl-
- NSC 5595
- 2,5-Dimethyl-2,5-hexanediol