CAS 110-11-2
:Octyl sulfate
Description:
Octyl sulfate, with the CAS number 110-11-2, is an organic compound characterized by its long hydrophobic octyl chain and a sulfate functional group. It is typically found as a surfactant, which means it has the ability to reduce surface tension between liquids or between a liquid and a solid. This property makes octyl sulfate useful in various applications, including detergents, emulsifiers, and wetting agents. The compound is generally soluble in organic solvents but has limited solubility in water due to its hydrophobic nature. Octyl sulfate can exhibit both anionic and nonionic characteristics, depending on the specific formulation and conditions. Its structure allows it to interact with both polar and nonpolar substances, making it versatile in formulations. Additionally, octyl sulfate may have implications in biological systems, where it can influence membrane dynamics and cellular interactions. Safety data should be consulted for handling and exposure, as with any chemical substance, to ensure proper precautions are taken.
Formula:C8H18O4S
InChI:InChI=1S/C8H18O4S/c1-2-3-4-5-6-7-8-12-13(9,10)11/h2-8H2,1H3,(H,9,10,11)
InChI key:InChIKey=UZZYXUGECOQHPU-UHFFFAOYSA-N
SMILES:O(CCCCCCCC)S(=O)(=O)O
Synonyms:- Empimin LV 33
- Lv 33
- Monooctyl sulfate
- Octyl Hydrogen Sulfate
- Octyl sulfate
- Octyl sulfate (C<sub>8</sub>H<sub>17</sub>SO<sub>4</sub>H)
- Sulfuric acid mono(1-octyl) ester
- Sulfuric acid, monooctyl ester
- Octyl sulfate (C8H17SO4H)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.