CAS 110-48-5
:3-(1-Methylethoxy)-1-propanol
Description:
3-(1-Methylethoxy)-1-propanol, also known by its CAS number 110-48-5, is an organic compound characterized by its structure, which includes a propanol backbone with an ethoxy group. This substance is typically a colorless liquid with a mild odor, and it is soluble in water and various organic solvents, making it versatile for use in different applications. It exhibits properties such as moderate volatility and a relatively low boiling point, which can influence its behavior in chemical processes. The compound is often utilized as a solvent in industrial applications, particularly in the formulation of paints, coatings, and adhesives. Additionally, it may serve as an intermediate in the synthesis of other chemical compounds. Safety data indicates that it should be handled with care, as it may cause irritation upon contact with skin or eyes and can be harmful if ingested or inhaled. Proper storage and handling procedures are essential to mitigate any potential hazards associated with its use.
Formula:C6H14O2
InChI:InChI=1S/C6H14O2/c1-6(2)8-5-3-4-7/h6-7H,3-5H2,1-2H3
InChI key:InChIKey=GBSGXZBOFKJGMG-UHFFFAOYSA-N
SMILES:O(CCCO)C(C)C
Synonyms:- 1-Propanol, 3- (1-methylethoxy)-
- 1-Propanol, 3-isopropoxy-
- 3-(1-Methylethoxy)-1-propanol
- 3-Isopropoxy-1-propanol
- 3-Isopropoxypropan-1-ol
- 3-Propan-2-yloxypropan-1-ol
- NSC 221256
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
3-Isopropoxy-1-propanol
CAS:3-Isopropoxy-1-propanol is a molecule that consists of a hydroxyl group, three isopropoxy groups, and a carboxylic acid. It has two functionalities: the hydroxyl group can act as an alcohol, while the carboxylic acid can act as an acid. 3-Isopropoxy-1-propanol can be used in the synthesis of malonic acid with copper (II) chloride. It also has a role in purification of glycol ethers and fatty acids by radiation. This molecule is used as a crosslinking agent for polymeric matrices and it reacts with hydrogen fluoride to form intramolecular hydrogen bonds. 3-Isopropoxy-1-propanol reacts with carbonyl groups to form ketones or esters.Formula:C8H16N2OPurity:Min. 95%Molecular weight:156.23 g/mol
