CAS 110008-25-8
:1-(3-aminopropyl)-1H-pyrrole-2,5-dione
Description:
1-(3-Aminopropyl)-1H-pyrrole-2,5-dione, with the CAS number 110008-25-8, is a chemical compound characterized by its pyrrole structure, which features a five-membered aromatic ring containing nitrogen atoms. This compound contains an amino group attached to a propyl chain, contributing to its potential reactivity and biological activity. The presence of the dione functional groups indicates that it has two carbonyl groups, which can participate in various chemical reactions, such as nucleophilic additions or condensation reactions. The compound is likely to exhibit polar characteristics due to the amino and carbonyl groups, influencing its solubility in polar solvents. Additionally, the structure suggests potential applications in pharmaceuticals or as a biochemical probe, given the importance of pyrrole derivatives in medicinal chemistry. However, specific properties such as melting point, boiling point, and solubility would require empirical data for precise characterization. Safety and handling precautions should be observed, as with any chemical substance, particularly those with biological activity.
Formula:C7H10N2O2
InChI:InChI=1/C7H10N2O2/c8-4-1-5-9-6(10)2-3-7(9)11/h2-3H,1,4-5,8H2
SMILES:C(CN)CN1C(=O)C=CC1=O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.