CAS 110011-49-9

2-Pyrrolidinone, 3-methyl-5-[3,5,7-trihydroxy-2-(4-hydroxyphenyl)-4-oxo-4H-1-benzopyran-8-yl]-

Description:

2-Pyrrolidinone, 3-methyl-5-[3,5,7-trihydroxy-2-(4-hydroxyphenyl)-4-oxo-4H-1-benzopyran-8-yl]- is a complex organic compound characterized by its unique structural features, which include a pyrrolidinone ring and a benzopyran moiety. This compound is notable for its potential biological activities, particularly in the realm of medicinal chemistry, where it may exhibit antioxidant, anti-inflammatory, or other therapeutic properties. The presence of multiple hydroxyl groups in its structure suggests that it could engage in hydrogen bonding, influencing its solubility and reactivity. Additionally, the compound's molecular framework may allow for interactions with various biological targets, making it of interest for drug development. Its CAS number, 110011-49-9, serves as a unique identifier for regulatory and research purposes. Overall, this substance exemplifies the intricate relationship between molecular structure and biological function, highlighting the importance of such compounds in pharmaceutical research and development.

Formula: C₂₀H₁₇NO₇

InChI: InChI=1/C20H17NO7/c1-8-6-11(21-20(8)27)14-12(23)7-13(24)15-16(25)17(26)18(28-19(14)15)9-2-4-10(22)5-3-9/h2-5,7-8,11,22-24,26H,6H2,1H3,(H,21,27)

InChI key: InChIKey=YDCRQLJCXBNURP-UHFFFAOYSA-N

SMILES: OC=1C(=C2C(C(=O)C(O)=C(O2)C3=CC=C(O)C=C3)=C(O)C1)C4CC(C)C(=O)N4

Synonyms:

• 2-Pyrrolidinone, 3-methyl-5-[3,5,7-trihydroxy-2-(4-hydroxyphenyl)-4-oxo-4H-1-benzopyran-8-yl]-
• (+)-Lilaline
• Lilaline

Lilaline

CAS: 110011-49-9

Formula: C₂₀H₁₇NO₇

Molecular weight: 383.36

Ref: 4Z-K-013007