CymitQuimica logo

CAS 110012-78-7

:

1-({[(1E)-1-(2-amino-1,3-thiazol-4-yl)-2-{[(2S,3S)-2-(fluoromethyl)-4-oxo-1-(2H-tetrazol-5-yl)azetidin-3-yl]amino}-2-oxoethylidene]amino}oxy)cyclobutanecarboxylic acid

Description:
The chemical substance known as 1-({[(1E)-1-(2-amino-1,3-thiazol-4-yl)-2-{[(2S,3S)-2-(fluoromethyl)-4-oxo-1-(2H-tetrazol-5-yl)azetidin-3-yl]amino}-2-oxoethylidene]amino}oxy)cyclobutanecarboxylic acid, with CAS number 110012-78-7, is a complex organic compound characterized by its multi-functional groups and structural diversity. It features a cyclobutane ring, which contributes to its rigidity and potential biological activity. The presence of thiazole and tetrazole moieties suggests potential interactions with biological targets, making it of interest in medicinal chemistry. The compound also contains amino and carboxylic acid functional groups, which can participate in hydrogen bonding and ionic interactions, enhancing its solubility and reactivity. Additionally, the fluoromethyl group may influence its pharmacokinetic properties, such as lipophilicity and metabolic stability. Overall, this compound's intricate structure and functional groups indicate potential applications in drug development, particularly in targeting specific biological pathways or diseases.
Formula:C15H16FN9O5S
InChI:InChI=1/C15H16FN9O5S/c16-4-7-9(11(27)25(7)14-20-23-24-21-14)19-10(26)8(6-5-31-13(17)18-6)22-30-15(12(28)29)2-1-3-15/h5,7,9H,1-4H2,(H2,17,18)(H,19,26)(H,28,29)(H,20,21,23,24)/b22-8+/t7-,9+/m1/s1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
  • RU 44790

    CAS:
    RU 44790 is a synthetic monocyclic beta-lactam antibiotics.
    Formula:C15H16FN9O5S
    Color and Shape:Solid
    Molecular weight:453.41

    Ref: TM-T26153

    25mg
    To inquire
    50mg
    To inquire
    100mg
    To inquire