CAS 1100212-67-6

5-(Trifluoromethyl)-1H-indazole-7-carboxaldehyde

Description:

5-(Trifluoromethyl)-1H-indazole-7-carboxaldehyde is a chemical compound characterized by its indazole core, which is a five-membered aromatic heterocycle containing two nitrogen atoms. The presence of a trifluoromethyl group (-CF3) at the 5-position significantly influences its electronic properties, enhancing lipophilicity and potentially affecting its reactivity and biological activity. The aldehyde functional group (-CHO) at the 7-position introduces reactivity typical of aldehydes, allowing for various chemical transformations, including condensation and reduction reactions. This compound is of interest in medicinal chemistry and material science due to its potential applications in drug development and as a building block for synthesizing more complex molecules. Its unique structure may also impart specific interactions with biological targets, making it a candidate for further investigation in pharmacological studies. As with many fluorinated compounds, it may exhibit distinct physical and chemical properties, such as increased stability and altered solubility compared to non-fluorinated analogs.

Formula: C₉H₅F₃N₂O

InChI: InChI=1S/C9H5F3N2O/c10-9(11,12)7-1-5-3-13-14-8(5)6(2-7)4-15/h1-4H,(H,13,14)

InChI key: InChIKey=WAUYYAVBIIYPLR-UHFFFAOYSA-N

SMILES: C(=O)C1=C2C(=CC(C(F)(F)F)=C1)C=NN2

Synonyms:

• 5-(Trifluoromethyl)-1H-indazole-7-carboxaldehyde
• 1H-Indazole-7-carboxaldehyde, 5-(trifluoromethyl)-