CAS 11006-91-0
:Aloinoside B
Description:
Aloinoside B is a chemical compound classified as a glycoside, specifically derived from the plant genus Aloe. It is known for its potential biological activities, which may include anti-inflammatory and antimicrobial properties. The structure of Aloinoside B features a sugar moiety linked to a non-sugar component, which is characteristic of glycosides, allowing it to exhibit various pharmacological effects. Its CAS number, 11006-91-0, is a unique identifier that helps in the cataloging and identification of this compound in chemical databases. Aloinoside B is often studied for its role in traditional medicine and its potential applications in modern therapeutics. As with many natural products, the extraction and purification processes can influence its availability and concentration, making it a subject of interest in both pharmaceutical and nutritional research. Further studies are necessary to fully elucidate its mechanisms of action and potential health benefits.
Formula:C27H32O13
InChI:InChI=1S/C27H32O13/c1-9-19(31)22(34)25(37)27(39-9)38-8-10-5-12-16(26-24(36)23(35)20(32)15(7-28)40-26)11-3-2-4-13(29)17(11)21(33)18(12)14(30)6-10/h2-6,9,15-16,19-20,22-32,34-37H,7-8H2,1H3/t9-,15+,16+,19-,20+,22+,23-,24+,25+,26-,27+/m0/s1
InChI key:InChIKey=BUPDVJFRVYWYEV-SGAFVUFDSA-N
SMILES:O[C@H]1[C@]([C@]2(C=3C(C(=O)C=4C2=CC=CC4O)=C(O)C=C(CO[C@H]5[C@H](O)[C@H](O)[C@@H](O)[C@H](C)O5)C3)[H])(O[C@H](CO)[C@@H](O)[C@@H]1O)[H]
Synonyms:- (10R)-3-[[(6-Deoxy-α-<span class="text-smallcaps">L</smallcap>-mannopyranosyl)oxy]methyl]-10-β-<smallcap>D</span>-glucopyranosyl-1,8-dihydroxy-9(10H)-anthracenone
- 10-Deoxyaloinoside D
- 11-O-Rhamnosylaloin B
- 9(10H)-Anthracenone, 3-[[(6-deoxy-α-<span class="text-smallcaps">L</smallcap>-mannopyranosyl)oxy]methyl]-10-β-<smallcap>D</span>-glucopyranosyl-1,8-dihydroxy-, (10R)-
- 9(10H)-Anthracenone, 3-[[(6-deoxy-α-<span class="text-smallcaps">L</smallcap>-mannopyranosyl)oxy]methyl]-10-β-<smallcap>D</span>-glucopyranosyl-1,8-dihydroxy-, (R)-
- 9(10H)-Anthracenone,3-[[(6-deoxy-a-L-mannopyranosyl)oxy]methyl]-10-b-D-glucopyranosyl-1,8-dihydroxy-,(R)-
- Aloinoside
- Aloinoside B
- Aloinoside B (7CI,8CI)
- (10R)-3-[[(6-Deoxy-α-L-mannopyranosyl)oxy]methyl]-10-β-D-glucopyranosyl-1,8-dihydroxy-9(10H)-anthracenone
- 9(10H)-Anthracenone, 3-[[(6-deoxy-α-L-mannopyranosyl)oxy]methyl]-10-β-D-glucopyranosyl-1,8-dihydroxy-, (10R)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Aloinoside B
CAS:Aloinoside B (11-o-Rhamnosylaloin B) is a glycoside from aloe vera.Formula:C27H32O13Purity:99.93%Color and Shape:SoildMolecular weight:564.54Aloinoside B
CAS:Aloinoside B is a naturally occurring anthrone C-glycoside, which is a type of secondary metabolite extracted from various Aloe species. It is primarily found in the latex of Aloe plants, where it functions as a defense compound. The mode of action of Aloinoside B involves the modulation of specific cellular pathways, which contributes to its biological properties. This compound exhibits a range of biological activities, including laxative effects due to its ability to influence water and electrolyte secretion in the intestinal lumen.Formula:C27H32O13Purity:Min. 95%Molecular weight:564.54 g/mol





