CAS 110072-98-5
:(+)-5-Propyl-2,4-imidazolidinedione
Description:
(+)-5-Propyl-2,4-imidazolidinedione, also known as a derivative of imidazolidinedione, is a chemical compound characterized by its bicyclic structure containing both nitrogen and carbon atoms. This compound typically exhibits a white to off-white crystalline appearance and is soluble in polar solvents. Its molecular structure includes a five-membered ring with two nitrogen atoms, contributing to its potential biological activity. The presence of the propyl group enhances its lipophilicity, which may influence its interaction with biological systems. This compound is often studied for its pharmacological properties, particularly in relation to its potential as a therapeutic agent. Additionally, it may participate in various chemical reactions due to the reactivity of the imidazolidinedione moiety, making it of interest in synthetic organic chemistry. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken. Overall, (+)-5-Propyl-2,4-imidazolidinedione represents a significant compound in medicinal chemistry and related fields.
Formula:C6H10N2O2
InChI:InChI=1/C6H10N2O2/c1-2-3-4-5(9)8-6(10)7-4/h4H,2-3H2,1H3,(H2,7,8,9,10)
InChI key:InChIKey=BIFASJFFCIDWDC-UHFFFAOYNA-N
SMILES:C(CC)C1C(=O)NC(=O)N1
Synonyms:- (+)-5-Propyl-2,4-imidazolidinedione
- 2,4-Imidazolidinedione, 5-propyl-, (+)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
