CymitQuimica logo

CAS 110073-83-1

:

2-Phenyl-1H-indole-6-carboxylic acid

Description:
2-Phenyl-1H-indole-6-carboxylic acid is an organic compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. This compound features a carboxylic acid functional group at the 6-position of the indole ring and a phenyl group at the 2-position. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. The presence of both the carboxylic acid and phenyl groups contributes to its potential for hydrogen bonding and π-π interactions, influencing its reactivity and interactions with other molecules. This compound may be of interest in various fields, including medicinal chemistry and materials science, due to its potential biological activity and utility in synthesizing other chemical entities. Additionally, its unique structure may allow for specific interactions with biological targets, making it a candidate for further research in drug development and related applications.
Formula:C15H11NO2
InChI:InChI=1S/C15H11NO2/c17-15(18)12-7-6-11-8-13(16-14(11)9-12)10-4-2-1-3-5-10/h1-9,16H,(H,17,18)
InChI key:InChIKey=BWKYFLQHMXEKJX-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C=C2C(C=C(N2)C3=CC=CC=C3)=CC1
Synonyms:
  • 2-Phenyl-1H-indole-6-carboxylic acid
  • 2-Phenyl-6-indolecarboxylic acid
  • 1H-Indole-6-carboxylic acid, 2-phenyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.