CAS 1100752-71-3
:4-Bromo-2-fluorobenzenecarboximidamide
Description:
4-Bromo-2-fluorobenzenecarboximidamide is an organic compound characterized by the presence of a bromine atom and a fluorine atom attached to a benzene ring, along with a carboximidamide functional group. This compound features a benzene ring substituted at the 4-position with a bromine atom and at the 2-position with a fluorine atom, which can influence its reactivity and interaction with biological systems. The carboximidamide group contributes to its potential as a ligand in coordination chemistry or as a precursor in organic synthesis. The presence of halogens typically enhances the compound's lipophilicity, which may affect its solubility and biological activity. Additionally, the specific arrangement of substituents can lead to unique electronic properties, making it of interest in medicinal chemistry and material science. As with many halogenated compounds, considerations regarding toxicity and environmental impact are essential, particularly in the context of regulatory frameworks governing chemical safety.
Formula:C7H6BrFN2
InChI:InChI=1S/C7H6BrFN2/c8-4-1-2-5(7(10)11)6(9)3-4/h1-3H,(H3,10,11)
InChI key:InChIKey=DCQNERUWUYQVSC-UHFFFAOYSA-N
SMILES:C(=N)(N)C1=C(F)C=C(Br)C=C1
Synonyms:- Benzenecarboximidamide, 4-bromo-2-fluoro-
- 4-Bromo-2-fluorobenzenecarboximidamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
4-Bromo-2-fluorobenzene-1-carboximidamide
CAS:4-Bromo-2-fluorobenzene-1-carboximidamide
Molecular weight:217.03834g/mol

