
CAS 110076-51-2
:5-[[(3-Methoxyphenyl)methyl]thio]-1,3,4-thiadiazol-2-amine
Description:
5-[[(3-Methoxyphenyl)methyl]thio]-1,3,4-thiadiazol-2-amine is a chemical compound characterized by its unique structure, which includes a thiadiazole ring and a methoxyphenyl group. The presence of the thiadiazole moiety contributes to its potential biological activity, as thiadiazoles are often associated with various pharmacological properties. The methoxy group enhances the compound's lipophilicity, potentially influencing its solubility and permeability. This compound may exhibit properties such as antimicrobial, antifungal, or anti-inflammatory activities, making it of interest in medicinal chemistry. Its molecular structure suggests that it could participate in hydrogen bonding and other interactions, which are crucial for its biological efficacy. Additionally, the compound's stability and reactivity can be influenced by the substituents on the thiadiazole and phenyl rings. Overall, 5-[[(3-Methoxyphenyl)methyl]thio]-1,3,4-thiadiazol-2-amine represents a class of compounds that may have significant applications in drug development and therapeutic research.
Formula:C10H11N3OS2
InChI:InChI=1S/C10H11N3OS2/c1-14-8-4-2-3-7(5-8)6-15-10-13-12-9(11)16-10/h2-5H,6H2,1H3,(H2,11,12)
InChI key:InChIKey=PTUKTIIOSZCEMY-UHFFFAOYSA-N
SMILES:C(SC1=NN=C(N)S1)C2=CC(OC)=CC=C2
Synonyms:- 1,3,4-Thiadiazol-2-amine, 5-[[(3-methoxyphenyl)methyl]thio]-
- 5-[[(3-Methoxyphenyl)methyl]thio]-1,3,4-thiadiazol-2-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.